C19H18BrCl2N5O3S2 — CID 100794741
2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide (PubChem CID 100794741) has the molecular formula C19H18BrCl2N5O3S2 and a molecular weight of 579.33 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 100794741 |
| Molecular Formula | C19H18BrCl2N5O3S2 |
| Molecular Weight | 579.33 g/mol |
| Exact Mass | 576.94 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(Br)cc1)NCCSc1ncn[nH]1 |
| InChI | InChI=1S/C19H18BrCl2N5O3S2/c20-14-2-5-16(6-3-14)32(29,30)27(10-13-1-4-15(21)9-17(13)22)11-18(28)23-7-8-31-19-24-12-25-26-19/h1-6,9,12H,7-8,10-11H2,(H,23,28)(H,24,25,26) |
| InChIKey | HDHIQGXRXCUJCV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|