C23H29N5O3S2 — CID 100795071
2-[(4-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide (PubChem CID 100795071) has the molecular formula C23H29N5O3S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[(4-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 100795071 |
| Molecular Formula | C23H29N5O3S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 2-[(4-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
| SMILES | Cc1ccc(CN(CC(=O)NCCSc2ncn[nH]2)S(=O)(=O)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C23H29N5O3S2/c1-16-5-7-20(8-6-16)13-28(14-21(29)24-9-10-32-23-25-15-26-27-23)33(30,31)22-18(3)11-17(2)12-19(22)4/h5-8,11-12,15H,9-10,13-14H2,1-4H3,(H,24,29)(H,25,26,27) |
| InChIKey | UJFXXYGJOFTOMH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|