C23H30Cl2N2O3S — CID 21373534
2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-pentylacetamide (PubChem CID 21373534) has the molecular formula C23H30Cl2N2O3S and a molecular weight of 485.48 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-pentylacetamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-pentylacetamide |
|---|---|
| PubChem CID | 21373534 |
| Molecular Formula | C23H30Cl2N2O3S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN(Cc1ccc(Cl)c(Cl)c1)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C23H30Cl2N2O3S/c1-5-6-7-10-26-22(28)15-27(14-19-8-9-20(24)21(25)13-19)31(29,30)23-17(3)11-16(2)12-18(23)4/h8-9,11-13H,5-7,10,14-15H2,1-4H3,(H,26,28) |
| InChIKey | JYZKFAARACBDTN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|