C26H25Cl2N3O5S — CID 126372612
4-[(E)-[[2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 126372612) has the molecular formula C26H25Cl2N3O5S and a molecular weight of 562.48 g/mol. Its IUPAC name is 4-[(E)-[[2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(E)-[[2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 126372612 |
| Molecular Formula | C26H25Cl2N3O5S |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | 4-[(E)-[[2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CC(=O)N/N=C/c2ccc(C(=O)O)cc2)Cc2ccc(Cl)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C26H25Cl2N3O5S/c1-16-10-17(2)25(18(3)11-16)37(35,36)31(14-20-6-9-22(27)23(28)12-20)15-24(32)30-29-13-19-4-7-21(8-5-19)26(33)34/h4-13H,14-15H2,1-3H3,(H,30,32)(H,33,34)/b29-13+ |
| InChIKey | KISFYFROEQVVKG-VFLNYLIXSA-N |
| XLogP | 4.96 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|