C27H31N3O3S — CID 4211690
N-[(4-methylphenyl)methylideneamino]-2-[(4-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide (PubChem CID 4211690) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-[(4-methylphenyl)methylideneamino]-2-[(4-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[(4-methylphenyl)methylideneamino]-2-[(4-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 4211690 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[(4-methylphenyl)methylideneamino]-2-[(4-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(C=NNC(=O)CN(Cc2ccc(C)cc2)S(=O)(=O)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C27H31N3O3S/c1-19-6-10-24(11-7-19)16-28-29-26(31)18-30(17-25-12-8-20(2)9-13-25)34(32,33)27-22(4)14-21(3)15-23(27)5/h6-16H,17-18H2,1-5H3,(H,29,31) |
| InChIKey | QAMFGTKUOAHZJP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|