C27H29Cl2N3O4S — CID 126375533
2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[(E)-(2-ethoxyphenyl)methylideneamino]acetamide (PubChem CID 126375533) has the molecular formula C27H29Cl2N3O4S and a molecular weight of 562.52 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[(E)-(2-ethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[(E)-(2-ethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126375533 |
| Molecular Formula | C27H29Cl2N3O4S |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[(E)-(2-ethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccccc1/C=N/NC(=O)CN(Cc1ccc(Cl)c(Cl)c1)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C27H29Cl2N3O4S/c1-5-36-25-9-7-6-8-22(25)15-30-31-26(33)17-32(16-21-10-11-23(28)24(29)14-21)37(34,35)27-19(3)12-18(2)13-20(27)4/h6-15H,5,16-17H2,1-4H3,(H,31,33)/b30-15+ |
| InChIKey | DBZOMSVMIBDHLR-FJEPWZHXSA-N |
| XLogP | 5.66 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|