C25H24Cl2N4O5S — CID 126377097
N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide (PubChem CID 126377097) has the molecular formula C25H24Cl2N4O5S and a molecular weight of 563.46 g/mol. Its IUPAC name is N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 126377097 |
| Molecular Formula | C25H24Cl2N4O5S |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CC(=O)N/N=C/c2cc([N+](=O)[O-])ccc2Cl)Cc2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C25H24Cl2N4O5S/c1-16-10-17(2)25(18(3)11-16)37(35,36)30(14-19-4-6-21(26)7-5-19)15-24(32)29-28-13-20-12-22(31(33)34)8-9-23(20)27/h4-13H,14-15H2,1-3H3,(H,29,32)/b28-13+ |
| InChIKey | MBAKPRCFUZHSMH-XODNFHPESA-N |
| XLogP | 5.17 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|