C23H20BrCl2N3O3S — CID 126128492
N-[(Z)-(2-bromophenyl)methylideneamino]-2-[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 126128492) has the molecular formula C23H20BrCl2N3O3S and a molecular weight of 569.31 g/mol. Its IUPAC name is N-[(Z)-(2-bromophenyl)methylideneamino]-2-[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[(Z)-(2-bromophenyl)methylideneamino]-2-[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 126128492 |
| Molecular Formula | C23H20BrCl2N3O3S |
| Molecular Weight | 569.31 g/mol |
| Exact Mass | 566.98 |
| IUPAC Name | N-[(Z)-(2-bromophenyl)methylideneamino]-2-[(3,4-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccccc2Br)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H20BrCl2N3O3S/c1-16-6-9-19(10-7-16)33(31,32)29(14-17-8-11-21(25)22(26)12-17)15-23(30)28-27-13-18-4-2-3-5-20(18)24/h2-13H,14-15H2,1H3,(H,28,30)/b27-13- |
| InChIKey | YGVFKTUUCNMCMV-WKIKZPBSSA-N |
| XLogP | 5.41 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.31 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|