C26H34N2O3S — CID 100782324
N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dimethylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 100782324) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dimethylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dimethylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 100782324 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dimethylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(CCc2ccccc2)CC(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C26H34N2O3S/c1-21-13-14-22(2)25(19-21)32(30,31)28(18-16-24-11-7-4-8-12-24)20-26(29)27-17-15-23-9-5-3-6-10-23/h4,7-9,11-14,19H,3,5-6,10,15-18,20H2,1-2H3,(H,27,29) |
| InChIKey | VUDPWCBLUXSJQZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|