C32H34N2O3S — CID 100782528
N,N-dibenzyl-2-[(2,5-dimethylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 100782528) has the molecular formula C32H34N2O3S and a molecular weight of 526.70 g/mol. Its IUPAC name is N,N-dibenzyl-2-[(2,5-dimethylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N,N-dibenzyl-2-[(2,5-dimethylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 100782528 |
| Molecular Formula | C32H34N2O3S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | N,N-dibenzyl-2-[(2,5-dimethylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(CCc2ccccc2)CC(=O)N(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C32H34N2O3S/c1-26-18-19-27(2)31(22-26)38(36,37)34(21-20-28-12-6-3-7-13-28)25-32(35)33(23-29-14-8-4-9-15-29)24-30-16-10-5-11-17-30/h3-19,22H,20-21,23-25H2,1-2H3 |
| InChIKey | OLHVISUIVSFDCU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |