C31H32N2O3S — CID 126067531
N,N-dibenzyl-2-[(4-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 126067531) has the molecular formula C31H32N2O3S and a molecular weight of 512.68 g/mol. Its IUPAC name is N,N-dibenzyl-2-[(4-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N,N-dibenzyl-2-[(4-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 126067531 |
| Molecular Formula | C31H32N2O3S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | N,N-dibenzyl-2-[(4-methylphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCc2ccccc2)CC(=O)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2O3S/c1-26-17-19-30(20-18-26)37(35,36)33(22-21-27-11-5-2-6-12-27)25-31(34)32(23-28-13-7-3-8-14-28)24-29-15-9-4-10-16-29/h2-20H,21-25H2,1H3 |
| InChIKey | WBKSIVXRFQOJIO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |