C39H43N3O6S3 — CID 10700219
N,N-bis[2-[benzyl-(4-methylphenyl)sulfonylamino]ethyl]-4-methylbenzenesulfonamide (PubChem CID 10700219) has the molecular formula C39H43N3O6S3 and a molecular weight of 745.99 g/mol. Its IUPAC name is N,N-bis[2-[benzyl-(4-methylphenyl)sulfonylamino]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N,N-bis[2-[benzyl-(4-methylphenyl)sulfonylamino]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10700219 |
| Molecular Formula | C39H43N3O6S3 |
| Molecular Weight | 745.99 g/mol |
| Exact Mass | 745.23 |
| IUPAC Name | N,N-bis[2-[benzyl-(4-methylphenyl)sulfonylamino]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCN(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)CCN(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C39H43N3O6S3/c1-32-14-20-37(21-15-32)49(43,44)40(26-28-41(30-35-10-6-4-7-11-35)50(45,46)38-22-16-33(2)17-23-38)27-29-42(31-36-12-8-5-9-13-36)51(47,48)39-24-18-34(3)19-25-39/h4-25H,26-31H2,1-3H3 |
| InChIKey | PTXOFTXYCBKVGC-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.99 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |