C23H35NO3SSi — CID 53306514
N-benzyl-N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylbenzenesulfonamide (PubChem CID 53306514) has the molecular formula C23H35NO3SSi and a molecular weight of 433.69 g/mol. Its IUPAC name is N-benzyl-N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 53306514 |
| Molecular Formula | C23H35NO3SSi |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-benzyl-N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCO[Si](C)(C)C(C)(C)C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H35NO3SSi/c1-20-13-15-22(16-14-20)28(25,26)24(19-21-11-8-7-9-12-21)17-10-18-27-29(5,6)23(2,3)4/h7-9,11-16H,10,17-19H2,1-6H3 |
| InChIKey | OEOJHMWZDFBLKX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|