C26H40N2O10S4 — CID 23242814
3-[(4-methylphenyl)sulfonyl-[4-[(4-methylphenyl)sulfonyl-(3-methylsulfonyloxypropyl)amino]butyl]amino]propyl methanesulfonate (PubChem CID 23242814) has the molecular formula C26H40N2O10S4 and a molecular weight of 668.88 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonyl-[4-[(4-methylphenyl)sulfonyl-(3-methylsulfonyloxypropyl)amino]butyl]amino]propyl methanesulfonate.
| Compound Name | 3-[(4-methylphenyl)sulfonyl-[4-[(4-methylphenyl)sulfonyl-(3-methylsulfonyloxypropyl)amino]butyl]amino]propyl methanesulfonate |
|---|---|
| PubChem CID | 23242814 |
| Molecular Formula | C26H40N2O10S4 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonyl-[4-[(4-methylphenyl)sulfonyl-(3-methylsulfonyloxypropyl)amino]butyl]amino]propyl methanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCCN(CCCOS(C)(=O)=O)S(=O)(=O)c2ccc(C)cc2)CCCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H40N2O10S4/c1-23-9-13-25(14-10-23)41(33,34)27(19-7-21-37-39(3,29)30)17-5-6-18-28(20-8-22-38-40(4,31)32)42(35,36)26-15-11-24(2)12-16-26/h9-16H,5-8,17-22H2,1-4H3 |
| InChIKey | BBDYRYXHZOURNL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 161.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|