C12H18NNaO6S2 — CID 59872860
sodium 2-[(4-methylphenyl)sulfonyl-propylamino]ethyl sulfate (PubChem CID 59872860) has the molecular formula C12H18NNaO6S2 and a molecular weight of 359.40 g/mol. Its IUPAC name is sodium 2-[(4-methylphenyl)sulfonyl-propylamino]ethyl sulfate.
| Compound Name | sodium 2-[(4-methylphenyl)sulfonyl-propylamino]ethyl sulfate |
|---|---|
| PubChem CID | 59872860 |
| Molecular Formula | C12H18NNaO6S2 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | sodium 2-[(4-methylphenyl)sulfonyl-propylamino]ethyl sulfate |
| SMILES | CCCN(CCOS(=O)(=O)[O-])S(=O)(=O)c1ccc(C)cc1.[Na+] |
| InChI | InChI=1S/C12H19NO6S2.Na/c1-3-8-13(9-10-19-21(16,17)18)20(14,15)12-6-4-11(2)5-7-12;/h4-7H,3,8-10H2,1-2H3,(H,16,17,18);/q;+1/p-1 |
| InChIKey | XHIMIMAFTQELIC-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|