C25H29NO8S3 — CID 141138384
2-[2-benzylsulfonyloxyethyl-(4-methylphenyl)sulfonylamino]ethyl phenylmethanesulfonate (PubChem CID 141138384) has the molecular formula C25H29NO8S3 and a molecular weight of 567.71 g/mol. Its IUPAC name is 2-[2-benzylsulfonyloxyethyl-(4-methylphenyl)sulfonylamino]ethyl phenylmethanesulfonate.
| Compound Name | 2-[2-benzylsulfonyloxyethyl-(4-methylphenyl)sulfonylamino]ethyl phenylmethanesulfonate |
|---|---|
| PubChem CID | 141138384 |
| Molecular Formula | C25H29NO8S3 |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | 2-[2-benzylsulfonyloxyethyl-(4-methylphenyl)sulfonylamino]ethyl phenylmethanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N(CCOS(=O)(=O)Cc2ccccc2)CCOS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H29NO8S3/c1-22-12-14-25(15-13-22)37(31,32)26(16-18-33-35(27,28)20-23-8-4-2-5-9-23)17-19-34-36(29,30)21-24-10-6-3-7-11-24/h2-15H,16-21H2,1H3 |
| InChIKey | DTARFEOCTBNASB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|