C23H25NO9S3 — CID 89155428
2-[2-(benzenesulfonyloxy)ethyl-(4-methoxyphenyl)sulfonylamino]ethyl benzenesulfonate (PubChem CID 89155428) has the molecular formula C23H25NO9S3 and a molecular weight of 555.65 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyloxy)ethyl-(4-methoxyphenyl)sulfonylamino]ethyl benzenesulfonate.
| Compound Name | 2-[2-(benzenesulfonyloxy)ethyl-(4-methoxyphenyl)sulfonylamino]ethyl benzenesulfonate |
|---|---|
| PubChem CID | 89155428 |
| Molecular Formula | C23H25NO9S3 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | 2-[2-(benzenesulfonyloxy)ethyl-(4-methoxyphenyl)sulfonylamino]ethyl benzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)N(CCOS(=O)(=O)c2ccccc2)CCOS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO9S3/c1-31-20-12-14-21(15-13-20)34(25,26)24(16-18-32-35(27,28)22-8-4-2-5-9-22)17-19-33-36(29,30)23-10-6-3-7-11-23/h2-15H,16-19H2,1H3 |
| InChIKey | GUIPPTCUJIXTCV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|