C18H32N2O5S — CID 54451158
N-[2-(hydroxyamino)oxyethyl]-4-methoxy-N-nonylbenzenesulfonamide (PubChem CID 54451158) has the molecular formula C18H32N2O5S and a molecular weight of 388.53 g/mol. Its IUPAC name is N-[2-(hydroxyamino)oxyethyl]-4-methoxy-N-nonylbenzenesulfonamide.
| Compound Name | N-[2-(hydroxyamino)oxyethyl]-4-methoxy-N-nonylbenzenesulfonamide |
|---|---|
| PubChem CID | 54451158 |
| Molecular Formula | C18H32N2O5S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[2-(hydroxyamino)oxyethyl]-4-methoxy-N-nonylbenzenesulfonamide |
| SMILES | CCCCCCCCCN(CCONO)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H32N2O5S/c1-3-4-5-6-7-8-9-14-20(15-16-25-19-21)26(22,23)18-12-10-17(24-2)11-13-18/h10-13,19,21H,3-9,14-16H2,1-2H3 |
| InChIKey | WVBGWFAYPAPKLJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|