C21H30N2O5S2 — CID 2187490
N,N-dibutyl-4-[(4-methoxyphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 2187490) has the molecular formula C21H30N2O5S2 and a molecular weight of 454.61 g/mol. Its IUPAC name is N,N-dibutyl-4-[(4-methoxyphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | N,N-dibutyl-4-[(4-methoxyphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 2187490 |
| Molecular Formula | C21H30N2O5S2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N,N-dibutyl-4-[(4-methoxyphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H30N2O5S2/c1-4-6-16-23(17-7-5-2)30(26,27)21-12-8-18(9-13-21)22-29(24,25)20-14-10-19(28-3)11-15-20/h8-15,22H,4-7,16-17H2,1-3H3 |
| InChIKey | RAXXQNLLPFAKQO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |