C16H27N3O6S2 — CID 20971352
4-methoxy-N-(2-methoxyethyl)-N-(2-piperazin-1-ylsulfonylethyl)benzenesulfonamide (PubChem CID 20971352) has the molecular formula C16H27N3O6S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-N-(2-piperazin-1-ylsulfonylethyl)benzenesulfonamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-N-(2-piperazin-1-ylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20971352 |
| Molecular Formula | C16H27N3O6S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-N-(2-piperazin-1-ylsulfonylethyl)benzenesulfonamide |
| SMILES | COCCN(CCS(=O)(=O)N1CCNCC1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H27N3O6S2/c1-24-13-11-19(12-14-26(20,21)18-9-7-17-8-10-18)27(22,23)16-5-3-15(25-2)4-6-16/h3-6,17H,7-14H2,1-2H3 |
| InChIKey | DCYLNKWJGMYTAV-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |