C13H16F3NO5S2 — CID 44632313
2-[(4-methylphenyl)sulfonyl-prop-2-enylamino]ethyl trifluoromethanesulfonate (PubChem CID 44632313) has the molecular formula C13H16F3NO5S2 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonyl-prop-2-enylamino]ethyl trifluoromethanesulfonate.
| Compound Name | 2-[(4-methylphenyl)sulfonyl-prop-2-enylamino]ethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44632313 |
| Molecular Formula | C13H16F3NO5S2 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonyl-prop-2-enylamino]ethyl trifluoromethanesulfonate |
| SMILES | C=CCN(CCOS(=O)(=O)C(F)(F)F)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H16F3NO5S2/c1-3-8-17(9-10-22-24(20,21)13(14,15)16)23(18,19)12-6-4-11(2)5-7-12/h3-7H,1,8-10H2,2H3 |
| InChIKey | UNNRDKJBXOOWMH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|