C24H26I2N2O4S2 — CID 102357733
N-[(1E,3E)-1,4-diiodo-4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]buta-1,3-dienyl]-4-methyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 102357733) has the molecular formula C24H26I2N2O4S2 and a molecular weight of 724.42 g/mol. Its IUPAC name is N-[(1E,3E)-1,4-diiodo-4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]buta-1,3-dienyl]-4-methyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[(1E,3E)-1,4-diiodo-4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]buta-1,3-dienyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 102357733 |
| Molecular Formula | C24H26I2N2O4S2 |
| Molecular Weight | 724.42 g/mol |
| Exact Mass | 723.94 |
| IUPAC Name | N-[(1E,3E)-1,4-diiodo-4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]buta-1,3-dienyl]-4-methyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(/C(I)=C\C=C(\I)N(CC=C)S(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H26I2N2O4S2/c1-5-17-27(33(29,30)21-11-7-19(3)8-12-21)23(25)15-16-24(26)28(18-6-2)34(31,32)22-13-9-20(4)10-14-22/h5-16H,1-2,17-18H2,3-4H3/b23-15-,24-16- |
| InChIKey | RTTNEUSPCDBJFE-MPKYGIEOSA-N |
| XLogP | 5.91 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|