C17H22Cl3NO3S — CID 10741129
2,2,2-trichloro-N-(4-methylphenyl)sulfonyl-N-oct-7-enylacetamide (PubChem CID 10741129) has the molecular formula C17H22Cl3NO3S and a molecular weight of 426.79 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(4-methylphenyl)sulfonyl-N-oct-7-enylacetamide.
| Compound Name | 2,2,2-trichloro-N-(4-methylphenyl)sulfonyl-N-oct-7-enylacetamide |
|---|---|
| PubChem CID | 10741129 |
| Molecular Formula | C17H22Cl3NO3S |
| Molecular Weight | 426.79 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2,2,2-trichloro-N-(4-methylphenyl)sulfonyl-N-oct-7-enylacetamide |
| SMILES | C=CCCCCCCN(C(=O)C(Cl)(Cl)Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H22Cl3NO3S/c1-3-4-5-6-7-8-13-21(16(22)17(18,19)20)25(23,24)15-11-9-14(2)10-12-15/h3,9-12H,1,4-8,13H2,2H3 |
| InChIKey | DSUVYXSVHKKAHX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|