C13H16ClNO3S — CID 102026014
2-[but-3-enyl-(4-methylphenyl)sulfonylamino]acetyl chloride (PubChem CID 102026014) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is 2-[but-3-enyl-(4-methylphenyl)sulfonylamino]acetyl chloride.
| Compound Name | 2-[but-3-enyl-(4-methylphenyl)sulfonylamino]acetyl chloride |
|---|---|
| PubChem CID | 102026014 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-[but-3-enyl-(4-methylphenyl)sulfonylamino]acetyl chloride |
| SMILES | C=CCCN(CC(=O)Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H16ClNO3S/c1-3-4-9-15(10-13(14)16)19(17,18)12-7-5-11(2)6-8-12/h3,5-8H,1,4,9-10H2,2H3 |
| InChIKey | IUBMUYVSXWTYHA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|