C20H21NO2S — CID 135077522
N-but-3-enyl-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide (PubChem CID 135077522) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-but-3-enyl-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide.
| Compound Name | N-but-3-enyl-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 135077522 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-but-3-enyl-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide |
| SMILES | C=CCCN(CC#Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO2S/c1-3-4-16-21(17-8-11-19-9-6-5-7-10-19)24(22,23)20-14-12-18(2)13-15-20/h3,5-7,9-10,12-15H,1,4,16-17H2,2H3 |
| InChIKey | HLEHJDGCOPEXJS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|