C23H20N2O2S — CID 135036563
N-[(E)-benzylideneamino]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide (PubChem CID 135036563) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide.
| Compound Name | N-[(E)-benzylideneamino]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 135036563 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[(E)-benzylideneamino]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC#Cc2ccccc2)/N=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O2S/c1-20-14-16-23(17-15-20)28(26,27)25(24-19-22-11-6-3-7-12-22)18-8-13-21-9-4-2-5-10-21/h2-7,9-12,14-17,19H,18H2,1H3/b24-19+ |
| InChIKey | OQDNZFCDHSFMCK-LYBHJNIJSA-N |
| XLogP | 4.07 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|