C23H19BrN2O2S — CID 138981299
N-[(E)-(4-bromophenyl)methylideneamino]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide (PubChem CID 138981299) has the molecular formula C23H19BrN2O2S and a molecular weight of 467.39 g/mol. Its IUPAC name is N-[(E)-(4-bromophenyl)methylideneamino]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide.
| Compound Name | N-[(E)-(4-bromophenyl)methylideneamino]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 138981299 |
| Molecular Formula | C23H19BrN2O2S |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | N-[(E)-(4-bromophenyl)methylideneamino]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC#Cc2ccccc2)/N=C/c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H19BrN2O2S/c1-19-9-15-23(16-10-19)29(27,28)26(17-5-8-20-6-3-2-4-7-20)25-18-21-11-13-22(24)14-12-21/h2-4,6-7,9-16,18H,17H2,1H3/b25-18+ |
| InChIKey | JSZPHILRRHMMGQ-XIEYBQDHSA-N |
| XLogP | 4.83 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|