C20H21N2O4S — CID 162416867
CID 162416867 (PubChem CID 162416867) has the molecular formula C20H21N2O4S and a molecular weight of 385.47 g/mol.
| Compound Name | CID 162416867 |
|---|---|
| PubChem CID | 162416867 |
| Molecular Formula | C20H21N2O4S |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | — |
| SMILES | C[C](CN(CC#Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1)C[N+](=O)[O-] |
| InChI | InChI=1S/C20H21N2O4S/c1-17-10-12-20(13-11-17)27(25,26)21(15-18(2)16-22(23)24)14-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-13H,14-16H2,1-2H3 |
| InChIKey | CRPWACUKYZVSMN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|