C26H29NO4S — CID 56588558
ethyl 2,2-dimethyl-6-[(4-methylphenyl)sulfonyl-(3-phenylprop-2-ynyl)amino]hex-4-ynoate (PubChem CID 56588558) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-6-[(4-methylphenyl)sulfonyl-(3-phenylprop-2-ynyl)amino]hex-4-ynoate.
| Compound Name | ethyl 2,2-dimethyl-6-[(4-methylphenyl)sulfonyl-(3-phenylprop-2-ynyl)amino]hex-4-ynoate |
|---|---|
| PubChem CID | 56588558 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | ethyl 2,2-dimethyl-6-[(4-methylphenyl)sulfonyl-(3-phenylprop-2-ynyl)amino]hex-4-ynoate |
| SMILES | CCOC(=O)C(C)(C)CC#CCN(CC#Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H29NO4S/c1-5-31-25(28)26(3,4)19-9-10-20-27(21-11-14-23-12-7-6-8-13-23)32(29,30)24-17-15-22(2)16-18-24/h6-8,12-13,15-18H,5,19-21H2,1-4H3 |
| InChIKey | CHGPSGWKHICDJZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|