C29H29NO4S2 — CID 16724424
N-[(3E)-3-(benzenesulfonyl)-5-methylhexa-3,5-dienyl]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide (PubChem CID 16724424) has the molecular formula C29H29NO4S2 and a molecular weight of 519.69 g/mol. Its IUPAC name is N-[(3E)-3-(benzenesulfonyl)-5-methylhexa-3,5-dienyl]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide.
| Compound Name | N-[(3E)-3-(benzenesulfonyl)-5-methylhexa-3,5-dienyl]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 16724424 |
| Molecular Formula | C29H29NO4S2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N-[(3E)-3-(benzenesulfonyl)-5-methylhexa-3,5-dienyl]-4-methyl-N-(3-phenylprop-2-ynyl)benzenesulfonamide |
| SMILES | C=C(C)/C=C(\CCN(CC#Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H29NO4S2/c1-24(2)23-29(35(31,32)27-14-8-5-9-15-27)20-22-30(21-10-13-26-11-6-4-7-12-26)36(33,34)28-18-16-25(3)17-19-28/h4-9,11-12,14-19,23H,1,20-22H2,2-3H3/b29-23+ |
| InChIKey | BBQXVTPCCDZXCZ-BYNJWEBRSA-N |
| XLogP | 5.36 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|