C43H37NO2S — CID 25227650
N,N-bis[(Z)-4,6-diphenylhex-3-en-5-ynyl]-4-methylbenzenesulfonamide (PubChem CID 25227650) has the molecular formula C43H37NO2S and a molecular weight of 631.84 g/mol. Its IUPAC name is N,N-bis[(Z)-4,6-diphenylhex-3-en-5-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N,N-bis[(Z)-4,6-diphenylhex-3-en-5-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25227650 |
| Molecular Formula | C43H37NO2S |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | N,N-bis[(Z)-4,6-diphenylhex-3-en-5-ynyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC/C=C(\C#Cc2ccccc2)c2ccccc2)CC/C=C(\C#Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H37NO2S/c1-36-26-32-43(33-27-36)47(45,46)44(34-14-24-41(39-20-10-4-11-21-39)30-28-37-16-6-2-7-17-37)35-15-25-42(40-22-12-5-13-23-40)31-29-38-18-8-3-9-19-38/h2-13,16-27,32-33H,14-15,34-35H2,1H3/b41-24+,42-25+ |
| InChIKey | QQVNSUJRFXSXRX-PBAHUFEMSA-N |
| XLogP | 9.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|