C21H23NO2S — CID 177395468
(E)-N,N-diethyl-2-(2-methylphenyl)-4-phenylbut-1-en-3-yne-1-sulfonamide (PubChem CID 177395468) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is (E)-N,N-diethyl-2-(2-methylphenyl)-4-phenylbut-1-en-3-yne-1-sulfonamide.
| Compound Name | (E)-N,N-diethyl-2-(2-methylphenyl)-4-phenylbut-1-en-3-yne-1-sulfonamide |
|---|---|
| PubChem CID | 177395468 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (E)-N,N-diethyl-2-(2-methylphenyl)-4-phenylbut-1-en-3-yne-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)/C=C(\C#Cc1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C21H23NO2S/c1-4-22(5-2)25(23,24)17-20(21-14-10-9-11-18(21)3)16-15-19-12-7-6-8-13-19/h6-14,17H,4-5H2,1-3H3/b20-17+ |
| InChIKey | PSSZGNQPIJVVAW-LVZFUZTISA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|