C16H14O2 — CID 122603261
2-ethyl-5-(2-phenylethynyl)benzene-1,3-diol (PubChem CID 122603261) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-ethyl-5-(2-phenylethynyl)benzene-1,3-diol.
| Compound Name | 2-ethyl-5-(2-phenylethynyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 122603261 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-ethyl-5-(2-phenylethynyl)benzene-1,3-diol |
| SMILES | CCc1c(O)cc(C#Cc2ccccc2)cc1O |
| InChI | InChI=1S/C16H14O2/c1-2-14-15(17)10-13(11-16(14)18)9-8-12-6-4-3-5-7-12/h3-7,10-11,17-18H,2H2,1H3 |
| InChIKey | KPRCLSWJMKXISS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|