C19H24O2 — CID 151036486
2,3,4-triethyl-5-(phenoxymethyl)phenol (PubChem CID 151036486) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2,3,4-triethyl-5-(phenoxymethyl)phenol.
| Compound Name | 2,3,4-triethyl-5-(phenoxymethyl)phenol |
|---|---|
| PubChem CID | 151036486 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2,3,4-triethyl-5-(phenoxymethyl)phenol |
| SMILES | CCc1c(O)cc(COc2ccccc2)c(CC)c1CC |
| InChI | InChI=1S/C19H24O2/c1-4-16-14(13-21-15-10-8-7-9-11-15)12-19(20)18(6-3)17(16)5-2/h7-12,20H,4-6,13H2,1-3H3 |
| InChIKey | MBEDWMXXXZOCNN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |