About 2-phenylethynylbenzene;hydrofluoride
2-phenylethynylbenzene;hydrofluoride (PubChem CID 158259923) has the molecular formula C14H11F
and a molecular weight of 198.24 g/mol. Its IUPAC name is 2-phenylethynylbenzene;hydrofluoride.
Molecular Properties
| Compound Name | 2-phenylethynylbenzene;hydrofluoride |
| PubChem CID | 158259923 |
| Molecular Formula | C14H11F |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-phenylethynylbenzene;hydrofluoride |
| SMILES | C(#Cc1ccccc1)c1ccccc1.F |
| InChI | InChI=1S/C14H10.FH/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;/h1-10H;1H |
| InChIKey | HXSOLLMEPPNCBV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethynylbenzene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethynylbenzene;hydrofluoride?
The IUPAC name of 2-phenylethynylbenzene;hydrofluoride (CID 158259923) is 2-phenylethynylbenzene;hydrofluoride.
What is the SMILES notation for 2-phenylethynylbenzene;hydrofluoride?
The canonical SMILES for 2-phenylethynylbenzene;hydrofluoride is C(#Cc1ccccc1)c1ccccc1.F.
What is the InChIKey of 2-phenylethynylbenzene;hydrofluoride?
The InChIKey is HXSOLLMEPPNCBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.FH/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;/h1-10H;1H.
What are the key properties of 2-phenylethynylbenzene;hydrofluoride?
2-phenylethynylbenzene;hydrofluoride has a molecular weight of 198.24 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethynylbenzene;hydrofluoride is sourced from PubChem (CID 158259923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).