About carbanide;dioxorhenium;2-phenylethynylbenzene
carbanide;dioxorhenium;2-phenylethynylbenzene (PubChem CID 134981110) has the molecular formula C15H13O2Re-
and a molecular weight of 411.47 g/mol. Its IUPAC name is carbanide;dioxorhenium;2-phenylethynylbenzene.
Molecular Properties
| Compound Name | carbanide;dioxorhenium;2-phenylethynylbenzene |
| PubChem CID | 134981110 |
| Molecular Formula | C15H13O2Re- |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | carbanide;dioxorhenium;2-phenylethynylbenzene |
| SMILES | C(#Cc1ccccc1)c1ccccc1.O=[Re]=O.[CH3-] |
| InChI | InChI=1S/C14H10.CH3.2O.Re/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;;;/h1-10H;1H3;;;/q;-1;;; |
| InChIKey | YXEDITQJNPUKPT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze carbanide;dioxorhenium;2-phenylethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;dioxorhenium;2-phenylethynylbenzene?
The IUPAC name of carbanide;dioxorhenium;2-phenylethynylbenzene (CID 134981110) is carbanide;dioxorhenium;2-phenylethynylbenzene.
What is the SMILES notation for carbanide;dioxorhenium;2-phenylethynylbenzene?
The canonical SMILES for carbanide;dioxorhenium;2-phenylethynylbenzene is C(#Cc1ccccc1)c1ccccc1.O=[Re]=O.[CH3-].
What is the InChIKey of carbanide;dioxorhenium;2-phenylethynylbenzene?
The InChIKey is YXEDITQJNPUKPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.CH3.2O.Re/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;;;/h1-10H;1H3;;;/q;-1;;;.
What are the key properties of carbanide;dioxorhenium;2-phenylethynylbenzene?
carbanide;dioxorhenium;2-phenylethynylbenzene has a molecular weight of 411.47 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;dioxorhenium;2-phenylethynylbenzene is sourced from PubChem (CID 134981110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).