About CID 173073657
CID 173073657 (PubChem CID 173073657) has the molecular formula C14H9Se
and a molecular weight of 256.19 g/mol.
Molecular Properties
| Compound Name | CID 173073657 |
| PubChem CID | 173073657 |
| Molecular Formula | C14H9Se |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | — |
| SMILES | [Se]c1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C14H9Se/c15-14-8-4-7-13(11-14)10-9-12-5-2-1-3-6-12/h1-8,11H |
| InChIKey | YCBGUFSIGMMJTB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 173073657 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173073657?
The IUPAC name of CID 173073657 (CID 173073657) is not available.
What is the SMILES notation for CID 173073657?
The canonical SMILES for CID 173073657 is [Se]c1cccc(C#Cc2ccccc2)c1.
What is the InChIKey of CID 173073657?
The InChIKey is YCBGUFSIGMMJTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Se/c15-14-8-4-7-13(11-14)10-9-12-5-2-1-3-6-12/h1-8,11H.
What are the key properties of CID 173073657?
CID 173073657 has a molecular weight of 256.19 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173073657 is sourced from PubChem (CID 173073657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).