C14H10 — CID 150731469
2-((1,2-13C2)cyclohexatrienyl)ethynyl(1,2-13C2)cyclohexatriene (PubChem CID 150731469) has the molecular formula C14H10 and a molecular weight of 182.20 g/mol. Its IUPAC name is 2-((1,2-13C2)cyclohexatrienyl)ethynyl(1,2-13C2)cyclohexatriene.
| Compound Name | 2-((1,2-13C2)cyclohexatrienyl)ethynyl(1,2-13C2)cyclohexatriene |
|---|---|
| PubChem CID | 150731469 |
| Molecular Formula | C14H10 |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-((1,2-13C2)cyclohexatrienyl)ethynyl(1,2-13C2)cyclohexatriene |
| SMILES | C(#C[13c]1cccc[13cH]1)[13c]1cccc[13cH]1 |
| InChI | InChI=1S/C14H10/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-10H/i7+1,9+1,13+1,14+1 |
| InChIKey | JRXXLCKWQFKACW-GNGMTCFNSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|