About 2-methylbut-2-ene;2-phenylethynylbenzene
2-methylbut-2-ene;2-phenylethynylbenzene (PubChem CID 143689109) has the molecular formula C19H20
and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-methylbut-2-ene;2-phenylethynylbenzene.
Molecular Properties
| Compound Name | 2-methylbut-2-ene;2-phenylethynylbenzene |
| PubChem CID | 143689109 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-methylbut-2-ene;2-phenylethynylbenzene |
| SMILES | C(#Cc1ccccc1)c1ccccc1.CC=C(C)C |
| InChI | InChI=1S/C14H10.C5H10/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-4-5(2)3/h1-10H;4H,1-3H3 |
| InChIKey | KIYZKQTYJNREJW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-2-ene;2-phenylethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-2-ene;2-phenylethynylbenzene?
The IUPAC name of 2-methylbut-2-ene;2-phenylethynylbenzene (CID 143689109) is 2-methylbut-2-ene;2-phenylethynylbenzene.
What is the SMILES notation for 2-methylbut-2-ene;2-phenylethynylbenzene?
The canonical SMILES for 2-methylbut-2-ene;2-phenylethynylbenzene is C(#Cc1ccccc1)c1ccccc1.CC=C(C)C.
What is the InChIKey of 2-methylbut-2-ene;2-phenylethynylbenzene?
The InChIKey is KIYZKQTYJNREJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C5H10/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-4-5(2)3/h1-10H;4H,1-3H3.
What are the key properties of 2-methylbut-2-ene;2-phenylethynylbenzene?
2-methylbut-2-ene;2-phenylethynylbenzene has a molecular weight of 248.37 g/mol, XLogP of 5.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-ene;2-phenylethynylbenzene is sourced from PubChem (CID 143689109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).