About S-ethylsulfanyl 2-methylbenzenecarbothioate
S-ethylsulfanyl 2-methylbenzenecarbothioate (PubChem CID 87154325) has the molecular formula C10H12OS2
and a molecular weight of 212.34 g/mol. Its IUPAC name is S-ethylsulfanyl 2-methylbenzenecarbothioate.
Molecular Properties
| Compound Name | S-ethylsulfanyl 2-methylbenzenecarbothioate |
| PubChem CID | 87154325 |
| Molecular Formula | C10H12OS2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | S-ethylsulfanyl 2-methylbenzenecarbothioate |
| SMILES | CCSSC(=O)c1ccccc1C |
| InChI | InChI=1S/C10H12OS2/c1-3-12-13-10(11)9-7-5-4-6-8(9)2/h4-7H,3H2,1-2H3 |
| InChIKey | LTGGYVLLUWTUIG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethylsulfanyl 2-methylbenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethylsulfanyl 2-methylbenzenecarbothioate?
The IUPAC name of S-ethylsulfanyl 2-methylbenzenecarbothioate (CID 87154325) is S-ethylsulfanyl 2-methylbenzenecarbothioate.
What is the SMILES notation for S-ethylsulfanyl 2-methylbenzenecarbothioate?
The canonical SMILES for S-ethylsulfanyl 2-methylbenzenecarbothioate is CCSSC(=O)c1ccccc1C.
What is the InChIKey of S-ethylsulfanyl 2-methylbenzenecarbothioate?
The InChIKey is LTGGYVLLUWTUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS2/c1-3-12-13-10(11)9-7-5-4-6-8(9)2/h4-7H,3H2,1-2H3.
What are the key properties of S-ethylsulfanyl 2-methylbenzenecarbothioate?
S-ethylsulfanyl 2-methylbenzenecarbothioate has a molecular weight of 212.34 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethylsulfanyl 2-methylbenzenecarbothioate is sourced from PubChem (CID 87154325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).