About 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene
1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene (PubChem CID 143750255) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene.
Molecular Properties
| Compound Name | 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene |
| PubChem CID | 143750255 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene |
| SMILES | C/C=C(\C=C/CC)c1ccccc1C |
| InChI | InChI=1S/C14H18/c1-4-6-10-13(5-2)14-11-8-7-9-12(14)3/h5-11H,4H2,1-3H3/b10-6-,13-5+ |
| InChIKey | ZYFXGGBWEBGCCS-GXUPAZJSSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene?
The IUPAC name of 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene (CID 143750255) is 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene.
What is the SMILES notation for 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene?
The canonical SMILES for 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene is C/C=C(\C=C/CC)c1ccccc1C.
What is the InChIKey of 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene?
The InChIKey is ZYFXGGBWEBGCCS-GXUPAZJSSA-N. The full InChI is InChI=1S/C14H18/c1-4-6-10-13(5-2)14-11-8-7-9-12(14)3/h5-11H,4H2,1-3H3/b10-6-,13-5+.
What are the key properties of 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene?
1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene has a molecular weight of 186.30 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methylbenzene is sourced from PubChem (CID 143750255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).