C10H14N2 — CID 129268082
(Z)-1-(2-methylphenyl)prop-1-ene-1,3-diamine (PubChem CID 129268082) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (Z)-1-(2-methylphenyl)prop-1-ene-1,3-diamine.
| Compound Name | (Z)-1-(2-methylphenyl)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 129268082 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (Z)-1-(2-methylphenyl)prop-1-ene-1,3-diamine |
| SMILES | Cc1ccccc1/C(N)=C/CN |
| InChI | InChI=1S/C10H14N2/c1-8-4-2-3-5-9(8)10(12)6-7-11/h2-6H,7,11-12H2,1H3/b10-6- |
| InChIKey | IZDRESRLRXBBNH-POHAHGRESA-N |
| XLogP | 1.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |