About CID 88514850
CID 88514850 (PubChem CID 88514850) has the molecular formula C17H17B
and a molecular weight of 232.13 g/mol.
Molecular Properties
| Compound Name | CID 88514850 |
| PubChem CID | 88514850 |
| Molecular Formula | C17H17B |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | — |
| SMILES | [B]CC=C(c1ccccc1C)c1ccccc1C |
| InChI | InChI=1S/C17H17B/c1-13-7-3-5-9-15(13)17(11-12-18)16-10-6-4-8-14(16)2/h3-11H,12H2,1-2H3 |
| InChIKey | QWWFBBLPAYTXSQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88514850 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88514850?
The IUPAC name of CID 88514850 (CID 88514850) is not available.
What is the SMILES notation for CID 88514850?
The canonical SMILES for CID 88514850 is [B]CC=C(c1ccccc1C)c1ccccc1C.
What is the InChIKey of CID 88514850?
The InChIKey is QWWFBBLPAYTXSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17B/c1-13-7-3-5-9-15(13)17(11-12-18)16-10-6-4-8-14(16)2/h3-11H,12H2,1-2H3.
What are the key properties of CID 88514850?
CID 88514850 has a molecular weight of 232.13 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88514850 is sourced from PubChem (CID 88514850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).