C23H30 — CID 143300739
cyclohepta-1,3,5-triene;ethene;1-[(2Z)-hepta-2,4-dien-4-yl]-2-methylbenzene (PubChem CID 143300739) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is cyclohepta-1,3,5-triene;ethene;1-[(2Z)-hepta-2,4-dien-4-yl]-2-methylbenzene.
| Compound Name | cyclohepta-1,3,5-triene;ethene;1-[(2Z)-hepta-2,4-dien-4-yl]-2-methylbenzene |
|---|---|
| PubChem CID | 143300739 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | cyclohepta-1,3,5-triene;ethene;1-[(2Z)-hepta-2,4-dien-4-yl]-2-methylbenzene |
| SMILES | C/C=C\C(=CCC)c1ccccc1C.C1=CC=CCC=C1.C=C |
| InChI | InChI=1S/C14H18.C7H8.C2H4/c1-4-8-13(9-5-2)14-11-7-6-10-12(14)3;1-2-4-6-7-5-3-1;1-2/h4,6-11H,5H2,1-3H3;1-6H,7H2;1-2H2/b8-4-,13-9?;; |
| InChIKey | AMJURZVGNNGOOQ-XJHLRWICSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|