C21H22 — CID 144508222
1-methyl-2-[(3E,5Z)-4-(2-methylphenyl)hepta-1,3,5-trien-2-yl]benzene (PubChem CID 144508222) has the molecular formula C21H22 and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-methyl-2-[(3E,5Z)-4-(2-methylphenyl)hepta-1,3,5-trien-2-yl]benzene.
| Compound Name | 1-methyl-2-[(3E,5Z)-4-(2-methylphenyl)hepta-1,3,5-trien-2-yl]benzene |
|---|---|
| PubChem CID | 144508222 |
| Molecular Formula | C21H22 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-methyl-2-[(3E,5Z)-4-(2-methylphenyl)hepta-1,3,5-trien-2-yl]benzene |
| SMILES | C=C(/C=C(\C=C/C)c1ccccc1C)c1ccccc1C |
| InChI | InChI=1S/C21H22/c1-5-10-19(21-14-9-7-12-17(21)3)15-18(4)20-13-8-6-11-16(20)2/h5-15H,4H2,1-3H3/b10-5-,19-15+ |
| InChIKey | HZFLWMWPGMTKFV-NQILAJBMSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|