C21H24 — CID 145063911
ethane;[(3E,5Z)-4-phenylhepta-1,3,5-trien-2-yl]benzene (PubChem CID 145063911) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is ethane;[(3E,5Z)-4-phenylhepta-1,3,5-trien-2-yl]benzene.
| Compound Name | ethane;[(3E,5Z)-4-phenylhepta-1,3,5-trien-2-yl]benzene |
|---|---|
| PubChem CID | 145063911 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | ethane;[(3E,5Z)-4-phenylhepta-1,3,5-trien-2-yl]benzene |
| SMILES | C=C(/C=C(\C=C/C)c1ccccc1)c1ccccc1.CC |
| InChI | InChI=1S/C19H18.C2H6/c1-3-10-19(18-13-8-5-9-14-18)15-16(2)17-11-6-4-7-12-17;1-2/h3-15H,2H2,1H3;1-2H3/b10-3-,19-15+; |
| InChIKey | KGTFXUFFHLKWCY-RYZXAZSQSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|