C33H39BO2 — CID 142425283
ethane;4,4,5,5-tetramethyl-2-[3-[3-[(3E,5Z)-2-phenylhepta-1,3,5-trien-4-yl]phenyl]phenyl]-1,3,2-dioxaborolane (PubChem CID 142425283) has the molecular formula C33H39BO2 and a molecular weight of 478.49 g/mol. Its IUPAC name is ethane;4,4,5,5-tetramethyl-2-[3-[3-[(3E,5Z)-2-phenylhepta-1,3,5-trien-4-yl]phenyl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | ethane;4,4,5,5-tetramethyl-2-[3-[3-[(3E,5Z)-2-phenylhepta-1,3,5-trien-4-yl]phenyl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142425283 |
| Molecular Formula | C33H39BO2 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | ethane;4,4,5,5-tetramethyl-2-[3-[3-[(3E,5Z)-2-phenylhepta-1,3,5-trien-4-yl]phenyl]phenyl]-1,3,2-dioxaborolane |
| SMILES | C=C(/C=C(\C=C/C)c1cccc(-c2cccc(B3OC(C)(C)C(C)(C)O3)c2)c1)c1ccccc1.CC |
| InChI | InChI=1S/C31H33BO2.C2H6/c1-7-13-25(20-23(2)24-14-9-8-10-15-24)26-16-11-17-27(21-26)28-18-12-19-29(22-28)32-33-30(3,4)31(5,6)34-32;1-2/h7-22H,2H2,1,3-6H3;1-2H3/b13-7-,25-20+; |
| InChIKey | DJBZTWABENIDFO-MYVVAUOWSA-N |
| XLogP | 8.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|