C18H23BO2 — CID 145390884
2-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 145390884) has the molecular formula C18H23BO2 and a molecular weight of 282.19 g/mol. Its IUPAC name is 2-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145390884 |
| Molecular Formula | C18H23BO2 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C/C=C(\C=C)c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C18H23BO2/c1-7-10-14(8-2)15-11-9-12-16(13-15)19-20-17(3,4)18(5,6)21-19/h7-13H,1-2H2,3-6H3/b14-10+ |
| InChIKey | JGGXJJHENNYLEH-GXDHUFHOSA-N |
| XLogP | 3.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|