C16H21BO3 — CID 156757981
4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]but-3-en-2-one (PubChem CID 156757981) has the molecular formula C16H21BO3 and a molecular weight of 272.15 g/mol. Its IUPAC name is 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]but-3-en-2-one.
| Compound Name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 156757981 |
| Molecular Formula | C16H21BO3 |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]but-3-en-2-one |
| SMILES | CC(=O)C=Cc1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H21BO3/c1-12(18)9-10-13-7-6-8-14(11-13)17-19-15(2,3)16(4,5)20-17/h6-11H,1-5H3 |
| InChIKey | GXUTZOLWCNBUPX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|