C46H64B2O6 — CID 102085896
2-[3-[(E)-2-[2,5-dihexoxy-4-[(E)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenyl]ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102085896) has the molecular formula C46H64B2O6 and a molecular weight of 734.64 g/mol. Its IUPAC name is 2-[3-[(E)-2-[2,5-dihexoxy-4-[(E)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenyl]ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-[(E)-2-[2,5-dihexoxy-4-[(E)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenyl]ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102085896 |
| Molecular Formula | C46H64B2O6 |
| Molecular Weight | 734.64 g/mol |
| Exact Mass | 734.49 |
| IUPAC Name | 2-[3-[(E)-2-[2,5-dihexoxy-4-[(E)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenyl]ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCOc1cc(/C=C/c2cccc(B3OC(C)(C)C(C)(C)O3)c2)c(OCCCCCC)cc1/C=C/c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C46H64B2O6/c1-11-13-15-17-29-49-41-33-38(28-26-36-22-20-24-40(32-36)48-53-45(7,8)46(9,10)54-48)42(50-30-18-16-14-12-2)34-37(41)27-25-35-21-19-23-39(31-35)47-51-43(3,4)44(5,6)52-47/h19-28,31-34H,11-18,29-30H2,1-10H3/b27-25+,28-26+ |
| InChIKey | UQXHLOOFEVVYLL-NBHCHVEOSA-N |
| XLogP | 10.54 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.64 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|